PRODUCTS
PRODUCTS
Chlorzoxazone |
Product name: | Chlorzoxazone |
CAS No.: | 95-25-0 |
EINECS No.: | 202-403-9 |
Molecular weight: | 169.57 |
Molecular formula: | C7H4ClNO2 |
InChI: | InChI=1/C7H4ClNO2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
Structural formula: | ![]() |
Melting point: | 189-194℃ |
Water solubility: | 0.1 g/100 mL |
Uses: | Central muscle relaxation medicine for various kinds of soft tissue pain caused by chronic sprain, contusion, muscle strain, etc., and muscle spasm pain caused by the central nervous system. |