PRODUCTS
PRODUCTS
Bispyribac-sodium |
Product name: | Bispyribac-sodium |
CAS No.: | 125401-92-5;125401-75-4 |
Molecular weight: | 452.35 |
Molecular formula: | C19H17N4NaO8 |
InChI: | InChI=1/C19H17N4NaO8/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4;/h5-9H,1-4H3,(H,24,25);/q;+1/p-1 |
Structural formula: | ![]() |
Melting point: | 223-224℃ |
Water solubility: | 73.3 g/l at 20°C |
Uses: | It is used to control weeds and broad-leaved weeds in paddy fields, such as paddy fields, live fields, seedling transplanting fields and seedling fields |